CAS 27173-18-8 is the registry number for 4-(3,5-Dibromophenyl)morpholine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-(3,5-dibromophenyl)morpholine (CAS 27173-18-8) is a chemical compound with the molecular formula C10H11Br2NO and a molecular weight of 321.01 g/mol. IUPAC name: 4-(3,5-dibromophenyl)morpholine. InChIKey: CIWAQOWDXYKITQ-UHFFFAOYSA-N.
| Molecular formula | C10H11Br2NO |
|---|---|
| Molecular weight | 321.01 g/mol |
| IUPAC name | 4-(3,5-dibromophenyl)morpholine |
| InChIKey | CIWAQOWDXYKITQ-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC(=CC(=C2)Br)Br |
Computed by PubChem (NCBI)