Products 1343819-12-4
CAS 1343819-12-4 is the registry number for 2-(2-(Trifluoromethyl)phenyl)cyclopentan-1-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[2-(trifluoromethyl)phenyl]cyclopentan-1-amine (CAS 1343819-12-4) is a chemical compound with the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]cyclopentan-1-amine. InChIKey: MTTDMGKJIKPRFW-UHFFFAOYSA-N.
| Molecular formula | C12H14F3N |
|---|---|
| Molecular weight | 229.24 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]cyclopentan-1-amine |
| InChIKey | MTTDMGKJIKPRFW-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)N)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)