Products 13440-12-5

CAS 13440-12-5 is the registry number for N1,N1,N1,N3,N3,N3-Hexamethylpropane-1,3-diaminium bromide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Trimethyl-[3-(trimethylazaniumyl)propyl]azanium dibromide (CAS 13440-12-5) is a chemical compound with the molecular formula C9H24Br2N2 and a molecular weight of 320.11 g/mol. IUPAC name: trimethyl-[3-(trimethylazaniumyl)propyl]azanium dibromide. InChIKey: GDVWHZUHXUQPDF-UHFFFAOYSA-L.

Identity
Molecular formulaC9H24Br2N2
Molecular weight320.11 g/mol
IUPAC nametrimethyl-[3-(trimethylazaniumyl)propyl]azanium dibromide
InChIKeyGDVWHZUHXUQPDF-UHFFFAOYSA-L
SMILESC[N+](C)(C)CCC[N+](C)(C)C.[Br-].[Br-]

Computed by PubChem (NCBI)