CAS 33968-67-1 appears in our catalog under these names: Colesevelam Aminoquat Impurity HBr, (6-Aminohexyl)trimethylammonium Bromide Hydrobromide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg.
6-aminohexyl(trimethyl)azanium;bromide;hydrobromide (CAS 33968-67-1) is a chemical compound with the molecular formula C9H24Br2N2 and a molecular weight of 320.11 g/mol. IUPAC name: 6-aminohexyl(trimethyl)azanium;bromide;hydrobromide. InChIKey: NIELYIRFOUAOEZ-UHFFFAOYSA-M.
| Molecular formula | C9H24Br2N2 |
|---|---|
| Molecular weight | 320.11 g/mol |
| IUPAC name | 6-aminohexyl(trimethyl)azanium;bromide;hydrobromide |
| InChIKey | NIELYIRFOUAOEZ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCCCCCN.Br.[Br-] |
Computed by PubChem (NCBI)