CAS 1344070-27-4 is the registry number for 4,4-Dimethylcyclohexane-1-sulfonyl chloride, 98%. Offered by: AmBeed. Available pack sizes: 1g, 10g, 5g.
4,4-dimethylcyclohexane-1-sulfonyl chloride (CAS 1344070-27-4) is a chemical compound with the molecular formula C8H15ClO2S and a molecular weight of 210.72 g/mol. IUPAC name: 4,4-dimethylcyclohexane-1-sulfonyl chloride. InChIKey: TZIFXIKYTZVVKH-UHFFFAOYSA-N.
| Molecular formula | C8H15ClO2S |
|---|---|
| Molecular weight | 210.72 g/mol |
| IUPAC name | 4,4-dimethylcyclohexane-1-sulfonyl chloride |
| InChIKey | TZIFXIKYTZVVKH-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)