Products 242459-87-6

CAS 242459-87-6 appears in our catalog under these names: Cycloheptylmethanesulfonyl chloride, 95%, Cycloheptylmethanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Cycloheptylmethanesulfonyl chloride (CAS 242459-87-6) is a chemical compound with the molecular formula C8H15ClO2S and a molecular weight of 210.72 g/mol. IUPAC name: cycloheptylmethanesulfonyl chloride. InChIKey: PFVAQJVYDIIETE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15ClO2S
Molecular weight210.72 g/mol
IUPAC namecycloheptylmethanesulfonyl chloride
InChIKeyPFVAQJVYDIIETE-UHFFFAOYSA-N
SMILESC1CCCC(CC1)CS(=O)(=O)Cl

Computed by PubChem (NCBI)