Products 134414-86-1

CAS 134414-86-1 is the registry number for (3,3-Dibromopropyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.

Structural formula: {0} (CAS {1})

3,3-dibromopropylbenzene (CAS 134414-86-1) is a chemical compound with the molecular formula C9H10Br2 and a molecular weight of 277.98 g/mol. IUPAC name: 3,3-dibromopropylbenzene. InChIKey: BJSQZVZJWJYJLR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Br2
Molecular weight277.98 g/mol
IUPAC name3,3-dibromopropylbenzene
InChIKeyBJSQZVZJWJYJLR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(Br)Br

Computed by PubChem (NCBI)