Products 1586-98-7

CAS 1586-98-7 is the registry number for (2,3-dibromopropyl)benzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

2,3-dibromopropylbenzene (CAS 1586-98-7) is a chemical compound with the molecular formula C9H10Br2 and a molecular weight of 277.98 g/mol. IUPAC name: 2,3-dibromopropylbenzene. InChIKey: NLQLBYPTOCXBJE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10Br2
Molecular weight277.98 g/mol
IUPAC name2,3-dibromopropylbenzene
InChIKeyNLQLBYPTOCXBJE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC(CBr)Br

Computed by PubChem (NCBI)