Products 1344158-47-9
CAS 1344158-47-9 is the registry number for Fmoc-Tiq(6-Me)-OH. Offered by: Iris Biotech. Available pack sizes: 100mg, 250mg.
2-(9H-fluoren-9-ylmethoxycarbonyl)-6-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid (CAS 1344158-47-9) is a chemical compound with the molecular formula C26H23NO4 and a molecular weight of 413.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonyl)-6-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid. InChIKey: PIXVJNCGDYBJJC-UHFFFAOYSA-N.
| Molecular formula | C26H23NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonyl)-6-methyl-3,4-dihydro-1H-isoquinoline-1-carboxylic acid |
| InChIKey | PIXVJNCGDYBJJC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(N(CC2)C(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)