Products 134424-54-7
CAS 134424-54-7 is the registry number for trans-Cyclohexane-p-bis(C-OTs). Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate (CAS 134424-54-7) is a chemical compound with the molecular formula C22H28O6S2 and a molecular weight of 452.6 g/mol. IUPAC name: [4-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate. InChIKey: UEDLGMJYAZLEHS-UHFFFAOYSA-N.
| Molecular formula | C22H28O6S2 |
|---|---|
| Molecular weight | 452.6 g/mol |
| IUPAC name | [4-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate |
| InChIKey | UEDLGMJYAZLEHS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2CCC(CC2)COS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)