CAS 59461-66-4 is the registry number for Lurasidone Impurity 74 . Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2S)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate (CAS 59461-66-4) is a chemical compound with the molecular formula C22H28O6S2 and a molecular weight of 452.6 g/mol. IUPAC name: [(1R,2S)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate. InChIKey: NURPVCDXVUVFBY-BGYRXZFFSA-N.
| Molecular formula | C22H28O6S2 |
|---|---|
| Molecular weight | 452.6 g/mol |
| IUPAC name | [(1R,2S)-2-[(4-methylphenyl)sulfonyloxymethyl]cyclohexyl]methyl 4-methylbenzenesulfonate |
| InChIKey | NURPVCDXVUVFBY-BGYRXZFFSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2CCCC[C@H]2COS(=O)(=O)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)