Products 1344309-71-2
CAS 1344309-71-2 appears in our catalog under these names: 5-Bromo-8-chloro-1,2-dihydroquinolin-2-one, 5-Bromo-8-chloro-1,2-dihydroquinolin-2-one, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
5-bromo-8-chloro-1H-quinolin-2-one (CAS 1344309-71-2) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 5-bromo-8-chloro-1H-quinolin-2-one. InChIKey: QGJFXRRKKZAHKS-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 5-bromo-8-chloro-1H-quinolin-2-one |
| InChIKey | QGJFXRRKKZAHKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)NC2=C(C=CC(=C21)Br)Cl |
Computed by PubChem (NCBI)