CAS 1344330-79-5 appears in our catalog under these names: 2-Bromo-5-((4-chlorophenyl)methyl)-1,3,4-thiadiazole, 2-Bromo-5-((4-chlorophenyl)methyl)-1,3,4-thiadiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-bromo-5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazole (CAS 1344330-79-5) is a chemical compound with the molecular formula C9H6BrClN2S and a molecular weight of 289.58 g/mol. IUPAC name: 2-bromo-5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazole. InChIKey: VCFJIQZDRWJWAX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2S |
|---|---|
| Molecular weight | 289.58 g/mol |
| IUPAC name | 2-bromo-5-[(4-chlorophenyl)methyl]-1,3,4-thiadiazole |
| InChIKey | VCFJIQZDRWJWAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NN=C(S2)Br)Cl |
Computed by PubChem (NCBI)