Products 1597807-52-7
CAS 1597807-52-7 is the registry number for 5-(3-Bromo-4-chlorophenyl)thiazol-2-amine, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-(3-bromo-4-chlorophenyl)-1,3-thiazol-2-amine (CAS 1597807-52-7) is a chemical compound with the molecular formula C9H6BrClN2S and a molecular weight of 289.58 g/mol. IUPAC name: 5-(3-bromo-4-chlorophenyl)-1,3-thiazol-2-amine. InChIKey: XTYPGPNYAMGJPS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2S |
|---|---|
| Molecular weight | 289.58 g/mol |
| IUPAC name | 5-(3-bromo-4-chlorophenyl)-1,3-thiazol-2-amine |
| InChIKey | XTYPGPNYAMGJPS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CN=C(S2)N)Br)Cl |
Computed by PubChem (NCBI)