Products 1344443-25-9
CAS 1344443-25-9 is the registry number for (S)-(4-(1-amino-2-methylpropyl)phenyl)(4-bromophenyl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[(1S)-1-amino-2-methylpropyl]phenyl]-(4-bromophenyl)methanone (CAS 1344443-25-9) is a chemical compound with the molecular formula C17H18BrNO and a molecular weight of 332.2 g/mol. IUPAC name: [4-[(1S)-1-amino-2-methylpropyl]phenyl]-(4-bromophenyl)methanone. InChIKey: LVLRUNPQBLNGMX-INIZCTEOSA-N.
| Molecular formula | C17H18BrNO |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | [4-[(1S)-1-amino-2-methylpropyl]phenyl]-(4-bromophenyl)methanone |
| InChIKey | LVLRUNPQBLNGMX-INIZCTEOSA-N |
| SMILES | CC(C)[C@@H](C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)