Products 1373233-42-1
CAS 1373233-42-1 is the registry number for 4-Bromo-N-cyclohexylnaphthalene-1-carboxamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
4-bromo-N-cyclohexylnaphthalene-1-carboxamide (CAS 1373233-42-1) is a chemical compound with the molecular formula C17H18BrNO and a molecular weight of 332.2 g/mol. IUPAC name: 4-bromo-N-cyclohexylnaphthalene-1-carboxamide. InChIKey: UIUZKTPSXVELHS-UHFFFAOYSA-N.
| Molecular formula | C17H18BrNO |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 4-bromo-N-cyclohexylnaphthalene-1-carboxamide |
| InChIKey | UIUZKTPSXVELHS-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)C2=CC=C(C3=CC=CC=C32)Br |
Computed by PubChem (NCBI)