Products 1344459-92-2
CAS 1344459-92-2 is the registry number for (S)-6-Bromo-4-fluoro-2,3-dihydrobenzofuran-3-amine, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg.
(3S)-6-bromo-4-fluoro-2,3-dihydro-1-benzofuran-3-amine (CAS 1344459-92-2) is a chemical compound with the molecular formula C8H7BrFNO and a molecular weight of 232.05 g/mol. IUPAC name: (3S)-6-bromo-4-fluoro-2,3-dihydro-1-benzofuran-3-amine. InChIKey: VKGYVOSAOJCKDK-ZCFIWIBFSA-N.
| Molecular formula | C8H7BrFNO |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | (3S)-6-bromo-4-fluoro-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | VKGYVOSAOJCKDK-ZCFIWIBFSA-N |
| SMILES | C1[C@H](C2=C(O1)C=C(C=C2F)Br)N |
Computed by PubChem (NCBI)