Products 1345471-14-8
CAS 1345471-14-8 is the registry number for 4-(4-Aminophenyl)-N-ethyl-2-fluorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(4-aminophenyl)-N-ethyl-2-fluorobenzamide (CAS 1345471-14-8) is a chemical compound with the molecular formula C15H15FN2O and a molecular weight of 258.29 g/mol. IUPAC name: 4-(4-aminophenyl)-N-ethyl-2-fluorobenzamide. InChIKey: FIPOKONOWFBQQZ-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 4-(4-aminophenyl)-N-ethyl-2-fluorobenzamide |
| InChIKey | FIPOKONOWFBQQZ-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(C=C(C=C1)C2=CC=C(C=C2)N)F |
Computed by PubChem (NCBI)