CAS 2279123-97-4 is the registry number for 5-Amino-4'-fluoro-biphenyl-3-carboxylic acid dimethylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-5-(4-fluorophenyl)-N,N-dimethylbenzamide (CAS 2279123-97-4) is a chemical compound with the molecular formula C15H15FN2O and a molecular weight of 258.29 g/mol. IUPAC name: 3-amino-5-(4-fluorophenyl)-N,N-dimethylbenzamide. InChIKey: CBDDQSKHFITVNI-UHFFFAOYSA-N.
| Molecular formula | C15H15FN2O |
|---|---|
| Molecular weight | 258.29 g/mol |
| IUPAC name | 3-amino-5-(4-fluorophenyl)-N,N-dimethylbenzamide |
| InChIKey | CBDDQSKHFITVNI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC(=CC(=C1)C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)