Products 1345471-80-8

CAS 1345471-80-8 is the registry number for 5-(2-Acetylphenyl)-2-fluorobenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

5-(2-acetylphenyl)-2-fluorobenzoic acid (CAS 1345471-80-8) is a chemical compound with the molecular formula C15H11FO3 and a molecular weight of 258.24 g/mol. IUPAC name: 5-(2-acetylphenyl)-2-fluorobenzoic acid. InChIKey: BQLBPFQXECRIIM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11FO3
Molecular weight258.24 g/mol
IUPAC name5-(2-acetylphenyl)-2-fluorobenzoic acid
InChIKeyBQLBPFQXECRIIM-UHFFFAOYSA-N
SMILESCC(=O)C1=CC=CC=C1C2=CC(=C(C=C2)F)C(=O)O

Computed by PubChem (NCBI)