Products 135276-47-0
CAS 135276-47-0 is the registry number for 1-(4-Fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione (CAS 135276-47-0) is a chemical compound with the molecular formula C15H11FO3 and a molecular weight of 258.24 g/mol. IUPAC name: 1-(4-fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione. InChIKey: LCNADOUVNLWSDQ-UHFFFAOYSA-N.
| Molecular formula | C15H11FO3 |
|---|---|
| Molecular weight | 258.24 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3-(2-hydroxyphenyl)propane-1,3-dione |
| InChIKey | LCNADOUVNLWSDQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC(=O)C2=CC=C(C=C2)F)O |
Computed by PubChem (NCBI)