CAS 1345471-92-2 is the registry number for 2-Bromo-4-fluoro-5-methyl-1,3-dinitrobenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-2-fluoro-1-methyl-3,5-dinitrobenzene (CAS 1345471-92-2) is a chemical compound with the molecular formula C7H4BrFN2O4 and a molecular weight of 279.02 g/mol. IUPAC name: 4-bromo-2-fluoro-1-methyl-3,5-dinitrobenzene. InChIKey: UYJGWOYVKZSFOC-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O4 |
|---|---|
| Molecular weight | 279.02 g/mol |
| IUPAC name | 4-bromo-2-fluoro-1-methyl-3,5-dinitrobenzene |
| InChIKey | UYJGWOYVKZSFOC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1F)[N+](=O)[O-])Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)