CAS 1352395-34-6 is the registry number for 4-Bromo-2,6-dinitro-3-fluorotoluene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
1-bromo-2-fluoro-4-methyl-3,5-dinitrobenzene (CAS 1352395-34-6) is a chemical compound with the molecular formula C7H4BrFN2O4 and a molecular weight of 279.02 g/mol. IUPAC name: 1-bromo-2-fluoro-4-methyl-3,5-dinitrobenzene. InChIKey: ZJBAUHXXUDSQSH-UHFFFAOYSA-N.
| Molecular formula | C7H4BrFN2O4 |
|---|---|
| Molecular weight | 279.02 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-methyl-3,5-dinitrobenzene |
| InChIKey | ZJBAUHXXUDSQSH-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1[N+](=O)[O-])Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)