CAS 1345472-03-8 is the registry number for 3,4'-Dimethyl-4-fluorobiphenyl, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-fluoro-2-methyl-4-(4-methylphenyl)benzene (CAS 1345472-03-8) is a chemical compound with the molecular formula C14H13F and a molecular weight of 200.25 g/mol. IUPAC name: 1-fluoro-2-methyl-4-(4-methylphenyl)benzene. InChIKey: LNPXILHXJFOCBT-UHFFFAOYSA-N.
| Molecular formula | C14H13F |
|---|---|
| Molecular weight | 200.25 g/mol |
| IUPAC name | 1-fluoro-2-methyl-4-(4-methylphenyl)benzene |
| InChIKey | LNPXILHXJFOCBT-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=C(C=C2)F)C |
Computed by PubChem (NCBI)