CAS 55258-76-9 appears in our catalog under these names: Flurbiprofen Impurity 4, 4-Ethyl-2-fluoro-1,1'-biphenyl, 4–ethyl–2–fluoro–1,1'–biphenyl, 4-Ethyl-2-fluoro-1,1'-biphenyl 97%, 4-ethyl-2-fluoro-1,1'-biphenyl, 97%, 97%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 100mg, 25mg, 50mg, 250mg, 1g, 100 mg.
4-ethyl-2-fluoro-1-phenylbenzene (CAS 55258-76-9) is a chemical compound with the molecular formula C14H13F and a molecular weight of 200.25 g/mol. IUPAC name: 4-ethyl-2-fluoro-1-phenylbenzene. InChIKey: GEBUSPQBSWYLBN-UHFFFAOYSA-N.
| Molecular formula | C14H13F |
|---|---|
| Molecular weight | 200.25 g/mol |
| IUPAC name | 4-ethyl-2-fluoro-1-phenylbenzene |
| InChIKey | GEBUSPQBSWYLBN-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)