Products 13456-39-8
CAS 13456-39-8 appears in our catalog under these names: Procaine Impurity 4, Pocaine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
2-(diethylamino)ethyl 4-nitrobenzoate (CAS 13456-39-8) is a chemical compound with the molecular formula C13H18N2O4 and a molecular weight of 266.29 g/mol. IUPAC name: 2-(diethylamino)ethyl 4-nitrobenzoate. InChIKey: FRESWUPYXIRXMN-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O4 |
|---|---|
| Molecular weight | 266.29 g/mol |
| IUPAC name | 2-(diethylamino)ethyl 4-nitrobenzoate |
| InChIKey | FRESWUPYXIRXMN-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Diethylaminoethyl 4-nitrobenzoate, 2-Diethylaminoethyl p-nitrobenzoate, 4-Nitrobenzoic acid 2-(diethylamino)ethyl ester, 2-(Diethylamino)ethyl 4-nitrobenzoate, Procaine Impurity 4, Benzoic acid, 4-nitro-,2-(diethylamino)ethyl ester, Procaine Impurity 30, FRESWUPYXIRXMN-UHFFFAOYSA-N, 2-(Diethylamino)ethyl 4-nitrobenzoate #, p-Nitrobenzoesaure-beta-diathylaminoathylester