CAS 1345866-65-0 is the registry number for Tz-benzoic acid. Offered by: Iris Biotech. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g.
4-(1,2,4,5-tetrazin-3-yl)benzoic acid (CAS 1345866-65-0) is a chemical compound with the molecular formula C9H6N4O2 and a molecular weight of 202.17 g/mol. IUPAC name: 4-(1,2,4,5-tetrazin-3-yl)benzoic acid. InChIKey: HLNAIFWMJUYFJW-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O2 |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 4-(1,2,4,5-tetrazin-3-yl)benzoic acid |
| InChIKey | HLNAIFWMJUYFJW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=CN=N2)C(=O)O |
Computed by PubChem (NCBI)