CAS 2091591-60-3 is the registry number for 7H-Pyrrolo[3',2':3,4]pyrrolo[2,1-f][1,2,4]triazine-6-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,6,10-pentaene-4-carboxylic acid (CAS 2091591-60-3) is a chemical compound with the molecular formula C9H6N4O2 and a molecular weight of 202.17 g/mol. IUPAC name: 5,8,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,6,10-pentaene-4-carboxylic acid. InChIKey: RZXFQSJNNUCOFV-UHFFFAOYSA-N.
| Molecular formula | C9H6N4O2 |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 5,8,9,11-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),2,4,6,10-pentaene-4-carboxylic acid |
| InChIKey | RZXFQSJNNUCOFV-UHFFFAOYSA-N |
| SMILES | C1=C2C3=CN=CNN3C=C2N=C1C(=O)O |
Computed by PubChem (NCBI)