CAS 1345955-29-4 is the registry number for Benzenemethanamine, 4-[6-(2-pyridinyl)-1,2,4,5-tetrazin-3-yl]-, tfa salt, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
[4-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)phenyl]methanamine (CAS 1345955-29-4) is a chemical compound with the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. IUPAC name: [4-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)phenyl]methanamine. InChIKey: ZKDJLNYWAXEYFL-UHFFFAOYSA-N.
| Molecular formula | C14H12N6 |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | [4-(6-pyridin-2-yl-1,2,4,5-tetrazin-3-yl)phenyl]methanamine |
| InChIKey | ZKDJLNYWAXEYFL-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NN=C(N=N2)C3=CC=C(C=C3)CN |
Computed by PubChem (NCBI)