Products 1670276-77-3
CAS 1670276-77-3 is the registry number for 5,5′-(1,4-Phenylene)bis[2-pyrimidinamine], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-[4-(2-aminopyrimidin-5-yl)phenyl]pyrimidin-2-amine (CAS 1670276-77-3) is a chemical compound with the molecular formula C14H12N6 and a molecular weight of 264.29 g/mol. IUPAC name: 5-[4-(2-aminopyrimidin-5-yl)phenyl]pyrimidin-2-amine. InChIKey: LIIINEVDVPWGAR-UHFFFAOYSA-N.
| Molecular formula | C14H12N6 |
|---|---|
| Molecular weight | 264.29 g/mol |
| IUPAC name | 5-[4-(2-aminopyrimidin-5-yl)phenyl]pyrimidin-2-amine |
| InChIKey | LIIINEVDVPWGAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(N=C2)N)C3=CN=C(N=C3)N |
Computed by PubChem (NCBI)