CAS 1346129-76-7 is the registry number for 4-Fluoro-2-iodo-6-(trifluoromethyl)phenol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2-iodo-6-(trifluoromethyl)phenol (CAS 1346129-76-7) is a chemical compound with the molecular formula C7H3F4IO and a molecular weight of 306.00 g/mol. IUPAC name: 4-fluoro-2-iodo-6-(trifluoromethyl)phenol. InChIKey: CZDDHJXSYYUEPT-UHFFFAOYSA-N.
| Molecular formula | C7H3F4IO |
|---|---|
| Molecular weight | 306.00 g/mol |
| IUPAC name | 4-fluoro-2-iodo-6-(trifluoromethyl)phenol |
| InChIKey | CZDDHJXSYYUEPT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)O)I)F |
Computed by PubChem (NCBI)