Products 2386337-76-2
CAS 2386337-76-2 is the registry number for 2-Fluoro-3-iodo-5-(trifluoromethyl)phenol, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-fluoro-3-iodo-5-(trifluoromethyl)phenol (CAS 2386337-76-2) is a chemical compound with the molecular formula C7H3F4IO and a molecular weight of 306.00 g/mol. IUPAC name: 2-fluoro-3-iodo-5-(trifluoromethyl)phenol. InChIKey: FNPGNSLQEXLSQH-UHFFFAOYSA-N.
| Molecular formula | C7H3F4IO |
|---|---|
| Molecular weight | 306.00 g/mol |
| IUPAC name | 2-fluoro-3-iodo-5-(trifluoromethyl)phenol |
| InChIKey | FNPGNSLQEXLSQH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)F)I)C(F)(F)F |
Computed by PubChem (NCBI)