CAS 1346153-07-8 appears in our catalog under these names: Boc-Pip-butyn, 95%, Boc–Pip–butyn, Boc-Pip-butyn 95%, tert-Butyl 4-(but-3-yn-1-yl)piperidine-1-carboxylate, 95%, 95%, Boc-Pip-butyn, 95.79%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
Tert-butyl 4-but-3-ynylpiperidine-1-carboxylate (CAS 1346153-07-8) is a chemical compound with the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. IUPAC name: tert-butyl 4-but-3-ynylpiperidine-1-carboxylate. InChIKey: QCJJQMHCBVBUPR-UHFFFAOYSA-N.
| Molecular formula | C14H23NO2 |
|---|---|
| Molecular weight | 237.34 g/mol |
| IUPAC name | tert-butyl 4-but-3-ynylpiperidine-1-carboxylate |
| InChIKey | QCJJQMHCBVBUPR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCC#C |
Computed by PubChem (NCBI)