Products 1346231-35-3
CAS 1346231-35-3 appears in our catalog under these names: Clopidogrel Impurity 37, Clopidogrel Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-(2-chlorophenyl)-2-[2-(hydroxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetate (CAS 1346231-35-3) is a chemical compound with the molecular formula C17H18ClNO3S and a molecular weight of 351.8 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-[2-(hydroxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetate. InChIKey: YYQHSWQHFKBARX-INIZCTEOSA-N.
| Molecular formula | C17H18ClNO3S |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-[2-(hydroxymethyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]acetate |
| InChIKey | YYQHSWQHFKBARX-INIZCTEOSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)C=C(S3)CO |
Computed by PubChem (NCBI)
Synonyms:
Clopidogrel Impurity 24, Clopidogrel Impurity 124