CAS 329-30-6 is the registry number for Chymotrypsin-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-chloro-3-oxo-1-phenylbutan-2-yl)-4-methylbenzenesulfonamide (CAS 329-30-6) is a chemical compound with the molecular formula C17H18ClNO3S and a molecular weight of 351.8 g/mol. IUPAC name: N-(4-chloro-3-oxo-1-phenylbutan-2-yl)-4-methylbenzenesulfonamide. InChIKey: MQUQNUAYKLCRME-UHFFFAOYSA-N.
| Molecular formula | C17H18ClNO3S |
|---|---|
| Molecular weight | 351.8 g/mol |
| IUPAC name | N-(4-chloro-3-oxo-1-phenylbutan-2-yl)-4-methylbenzenesulfonamide |
| InChIKey | MQUQNUAYKLCRME-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(CC2=CC=CC=C2)C(=O)CCl |
Computed by PubChem (NCBI)