Products 134628-42-5
CAS 134628-42-5 appears in our catalog under these names: Piperazine-2,2,3,3,5,5,6,6-d8, Piperazine-2,2,3,3,5,5,6,6-d8, 98 atom % D, min 98% Chemical Purity, Piperazine D8. Offered by: TRC, CDN, GLPBio. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g, 25mg.
2,2,3,3,5,5,6,6-octadeuteriopiperazine (CAS 134628-42-5) is a chemical compound with the molecular formula C4H10N2 and a molecular weight of 94.18 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuteriopiperazine. InChIKey: GLUUGHFHXGJENI-SVYQBANQSA-N.
| Molecular formula | C4H10N2 |
|---|---|
| Molecular weight | 94.18 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuteriopiperazine |
| InChIKey | GLUUGHFHXGJENI-SVYQBANQSA-N |
| SMILES | [2H]C1(C(NC(C(N1)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)