Products 362049-61-4
CAS 362049-61-4 is the registry number for Piperazine-d10, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1,2,2,3,3,4,5,5,6,6-decadeuteriopiperazine (CAS 362049-61-4) is a chemical compound with the molecular formula C4H10N2 and a molecular weight of 96.20 g/mol. IUPAC name: 1,2,2,3,3,4,5,5,6,6-decadeuteriopiperazine. InChIKey: GLUUGHFHXGJENI-YQMDOBQVSA-N.
| Molecular formula | C4H10N2 |
|---|---|
| Molecular weight | 96.20 g/mol |
| IUPAC name | 1,2,2,3,3,4,5,5,6,6-decadeuteriopiperazine |
| InChIKey | GLUUGHFHXGJENI-YQMDOBQVSA-N |
| SMILES | [2H]C1(C(N(C(C(N1[2H])([2H])[2H])([2H])[2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)