CAS 1346447-19-5 appears in our catalog under these names: 4,6-Dichloro-7-(phenylsulfonyl)-7h-pyrrolo[2,3-d]pyrimidine, 95%, 4,6-Dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 97%, 97%, 4,6-Dichloro-7-(phenylsulfonyl)-7H-pyrrolo[2,3-d]pyrimidine, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 50mg, 100mg.
7-(benzenesulfonyl)-4,6-dichloropyrrolo[2,3-d]pyrimidine (CAS 1346447-19-5) is a chemical compound with the molecular formula C12H7Cl2N3O2S and a molecular weight of 328.2 g/mol. IUPAC name: 7-(benzenesulfonyl)-4,6-dichloropyrrolo[2,3-d]pyrimidine. InChIKey: BJPGOHDUNIUCSD-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3O2S |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 7-(benzenesulfonyl)-4,6-dichloropyrrolo[2,3-d]pyrimidine |
| InChIKey | BJPGOHDUNIUCSD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=C2N=CN=C3Cl)Cl |
Computed by PubChem (NCBI)