CAS 2940951-83-5 is the registry number for 5-(benzenesulfonyl)-2,4-dichloro-pyrrolo[3,2-d]pyrimidine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(benzenesulfonyl)-2,4-dichloropyrrolo[3,2-d]pyrimidine (CAS 2940951-83-5) is a chemical compound with the molecular formula C12H7Cl2N3O2S and a molecular weight of 328.2 g/mol. IUPAC name: 5-(benzenesulfonyl)-2,4-dichloropyrrolo[3,2-d]pyrimidine. InChIKey: CCMLKOCZPHJCLG-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2N3O2S |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 5-(benzenesulfonyl)-2,4-dichloropyrrolo[3,2-d]pyrimidine |
| InChIKey | CCMLKOCZPHJCLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C2C(=NC(=N3)Cl)Cl |
Computed by PubChem (NCBI)