CAS 1346447-29-7 is the registry number for 6-Iodo-3,4-dihydro-2h-pyrano[3,2-b]pyridine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-iodo-3,4-dihydro-2H-pyrano[3,2-b]pyridine-8-carboxylic acid (CAS 1346447-29-7) is a chemical compound with the molecular formula C9H8INO3 and a molecular weight of 305.07 g/mol. IUPAC name: 6-iodo-3,4-dihydro-2H-pyrano[3,2-b]pyridine-8-carboxylic acid. InChIKey: YILXTUKWZXNMFP-UHFFFAOYSA-N.
| Molecular formula | C9H8INO3 |
|---|---|
| Molecular weight | 305.07 g/mol |
| IUPAC name | 6-iodo-3,4-dihydro-2H-pyrano[3,2-b]pyridine-8-carboxylic acid |
| InChIKey | YILXTUKWZXNMFP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=N2)I)C(=O)O)OC1 |
Computed by PubChem (NCBI)