CAS 52386-94-4 appears in our catalog under these names: m-Iodohippuric acid, m-Iodohippuric Acid (2-(3-iodobenzamido)acetic acid). Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3-iodobenzoyl)amino]acetic acid (CAS 52386-94-4) is a chemical compound with the molecular formula C9H8INO3 and a molecular weight of 305.07 g/mol. IUPAC name: 2-[(3-iodobenzoyl)amino]acetic acid. InChIKey: JFJVYCLGHWPODH-UHFFFAOYSA-N.
| Molecular formula | C9H8INO3 |
|---|---|
| Molecular weight | 305.07 g/mol |
| IUPAC name | 2-[(3-iodobenzoyl)amino]acetic acid |
| InChIKey | JFJVYCLGHWPODH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)I)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)