Products 1346447-42-4
CAS 1346447-42-4 is the registry number for 2-(tert-Butyl)-4-chlorooxazolo[4,5-c]pyridine-7-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
2-tert-butyl-4-chloro-[1,3]oxazolo[4,5-c]pyridine-7-carbonitrile (CAS 1346447-42-4) is a chemical compound with the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. IUPAC name: 2-tert-butyl-4-chloro-[1,3]oxazolo[4,5-c]pyridine-7-carbonitrile. InChIKey: ZHPGDUZRJLAWCR-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 2-tert-butyl-4-chloro-[1,3]oxazolo[4,5-c]pyridine-7-carbonitrile |
| InChIKey | ZHPGDUZRJLAWCR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(O1)C(=CN=C2Cl)C#N |
Computed by PubChem (NCBI)