CAS 1384428-67-4 appears in our catalog under these names: 2-Chloro-1-(1-(3-methylphenyl)-1H-1,2,3-triazol-4-yl)ethan-1-one, 95%, 2-Chloro-1-(1-(3-methylphenyl)-1H-1,2,3-triazol-4-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-1-[1-(3-methylphenyl)triazol-4-yl]ethanone (CAS 1384428-67-4) is a chemical compound with the molecular formula C11H10ClN3O and a molecular weight of 235.67 g/mol. IUPAC name: 2-chloro-1-[1-(3-methylphenyl)triazol-4-yl]ethanone. InChIKey: SYBUINUERLBAPT-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O |
|---|---|
| Molecular weight | 235.67 g/mol |
| IUPAC name | 2-chloro-1-[1-(3-methylphenyl)triazol-4-yl]ethanone |
| InChIKey | SYBUINUERLBAPT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C=C(N=N2)C(=O)CCl |
Computed by PubChem (NCBI)