CAS 1346534-62-0 is the registry number for 2-Ethyl-3-nitropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-ethyl-3-nitropyridine (CAS 1346534-62-0) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 2-ethyl-3-nitropyridine. InChIKey: YXEDTXYNYNFZTM-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 2-ethyl-3-nitropyridine |
| InChIKey | YXEDTXYNYNFZTM-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)