CAS 1346569-65-0 appears in our catalog under these names: Ethyl 5-amino-6-iodopyridine-2-carboxylate, 95%, ETHYL 5–AMINO–6–IODOPYRIDINE–2–CARBOXYLATE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Ethyl 5-amino-6-iodopyridine-2-carboxylate (CAS 1346569-65-0) is a chemical compound with the molecular formula C8H9IN2O2 and a molecular weight of 292.07 g/mol. IUPAC name: ethyl 5-amino-6-iodopyridine-2-carboxylate. InChIKey: VHNKLFOTQLAAEU-UHFFFAOYSA-N.
| Molecular formula | C8H9IN2O2 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | ethyl 5-amino-6-iodopyridine-2-carboxylate |
| InChIKey | VHNKLFOTQLAAEU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=C(C=C1)N)I |
Computed by PubChem (NCBI)