Products 857592-59-7
CAS 857592-59-7 is the registry number for 3-Iodo-N,N-dimethyl-4-nitroaniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-iodo-N,N-dimethyl-4-nitroaniline (CAS 857592-59-7) is a chemical compound with the molecular formula C8H9IN2O2 and a molecular weight of 292.07 g/mol. IUPAC name: 3-iodo-N,N-dimethyl-4-nitroaniline. InChIKey: MJSYFLMIHMPPRB-UHFFFAOYSA-N.
| Molecular formula | C8H9IN2O2 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | 3-iodo-N,N-dimethyl-4-nitroaniline |
| InChIKey | MJSYFLMIHMPPRB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)[N+](=O)[O-])I |
Computed by PubChem (NCBI)