Products 1346597-75-8

CAS 1346597-75-8 is the registry number for Mepivacaine N-oxide. Offered by: Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: on request, 250mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

N-(2,6-dimethylphenyl)-1-methyl-1-oxidopiperidin-1-ium-2-carboxamide (CAS 1346597-75-8) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-1-methyl-1-oxidopiperidin-1-ium-2-carboxamide. InChIKey: WQTJWODFSMCWCC-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22N2O2
Molecular weight262.35 g/mol
IUPAC nameN-(2,6-dimethylphenyl)-1-methyl-1-oxidopiperidin-1-ium-2-carboxamide
InChIKeyWQTJWODFSMCWCC-UHFFFAOYSA-N
SMILESCC1=C(C(=CC=C1)C)NC(=O)C2CCCC[N+]2(C)[O-]

Computed by PubChem (NCBI)