CAS 1346597-79-2 is the registry number for 3-Hydroxy Mepivacaine-d3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 0,25mg, 10mg, 1mg, 500 μg, 250 μg, 10 mg, 1 mg.
N-(3-hydroxy-2,6-dimethylphenyl)-1-(trideuteriomethyl)piperidine-2-carboxamide (CAS 1346597-79-2) is a chemical compound with the molecular formula C15H22N2O2 and a molecular weight of 265.37 g/mol. IUPAC name: N-(3-hydroxy-2,6-dimethylphenyl)-1-(trideuteriomethyl)piperidine-2-carboxamide. InChIKey: DVENKGUHBZKQPU-HPRDVNIFSA-N.
| Molecular formula | C15H22N2O2 |
|---|---|
| Molecular weight | 265.37 g/mol |
| IUPAC name | N-(3-hydroxy-2,6-dimethylphenyl)-1-(trideuteriomethyl)piperidine-2-carboxamide |
| InChIKey | DVENKGUHBZKQPU-HPRDVNIFSA-N |
| SMILES | [2H]C([2H])([2H])N1CCCCC1C(=O)NC2=C(C=CC(=C2C)O)C |
Computed by PubChem (NCBI)