Products 1346598-13-7
CAS 1346598-13-7 appears in our catalog under these names: Esmolol-d7 Hydrochloride, Esmolol–d7 (hydrochloride), Esmolol-d7 (hydrochloride). Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 1mg, 10mg, 5mg, 500μg, 1 mg, 10 mg, 5 mg.
Methyl 3-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]propanoate;hydrochloride (CAS 1346598-13-7) is a chemical compound with the molecular formula C16H26ClNO4 and a molecular weight of 338.88 g/mol. IUPAC name: methyl 3-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]propanoate;hydrochloride. InChIKey: GEKNCWBANDDJJL-ODLOEXKQSA-N.
| Molecular formula | C16H26ClNO4 |
|---|---|
| Molecular weight | 338.88 g/mol |
| IUPAC name | methyl 3-[4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]phenyl]propanoate;hydrochloride |
| InChIKey | GEKNCWBANDDJJL-ODLOEXKQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CCC(=O)OC)O.Cl |
Computed by PubChem (NCBI)