Products 1346598-17-1
CAS 1346598-17-1 appears in our catalog under these names: Ethyl Propionylacetate-d3, Ethyl 3-oxopentanoate-d3. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 5 mg, 1 mg, 10 mg.
Ethyl 5,5,5-trideuterio-3-oxopentanoate (CAS 1346598-17-1) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 147.19 g/mol. IUPAC name: ethyl 5,5,5-trideuterio-3-oxopentanoate. InChIKey: UDRCONFHWYGWFI-FIBGUPNXSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 147.19 g/mol |
| IUPAC name | ethyl 5,5,5-trideuterio-3-oxopentanoate |
| InChIKey | UDRCONFHWYGWFI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)CC(=O)OCC |
Computed by PubChem (NCBI)